C21H21N3O4S — CID 162803811
N-[(7S,8aR)-2-(4-acetylphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-thiophen-2-ylacetamide (PubChem CID 162803811) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is N-[(7S,8aR)-2-(4-acetylphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(7S,8aR)-2-(4-acetylphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 162803811 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-[(7S,8aR)-2-(4-acetylphenyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl]-2-thiophen-2-ylacetamide |
| SMILES | CC(=O)c1ccc(N2C(=O)[C@H]3C[C@@H](NC(=O)Cc4cccs4)CCN3C2=O)cc1 |
| InChI | InChI=1S/C21H21N3O4S/c1-13(25)14-4-6-16(7-5-14)24-20(27)18-11-15(8-9-23(18)21(24)28)22-19(26)12-17-3-2-10-29-17/h2-7,10,15,18H,8-9,11-12H2,1H3,(H,22,26)/t15-,18+/m0/s1 |
| InChIKey | KKWWUKZZMJDXGK-MAUKXSAKSA-N |
| XLogP | 2.61 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|