C24H24N4O5 — CID 4998319
9-(1,3-benzodioxol-5-yl)-3-(pyrrolidine-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 4998319) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is 9-(1,3-benzodioxol-5-yl)-3-(pyrrolidine-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | 9-(1,3-benzodioxol-5-yl)-3-(pyrrolidine-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 4998319 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 9-(1,3-benzodioxol-5-yl)-3-(pyrrolidine-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | O=C1Nc2ccc(-c3ccc4c(c3)OCO4)cc2C(=O)N2CCN(C(=O)C3CCCN3)CC12 |
| InChI | InChI=1S/C24H24N4O5/c29-22-19-12-27(24(31)18-2-1-7-25-18)8-9-28(19)23(30)16-10-14(3-5-17(16)26-22)15-4-6-20-21(11-15)33-13-32-20/h3-6,10-11,18-19,25H,1-2,7-9,12-13H2,(H,26,29) |
| InChIKey | DYJCEFNZENVVTF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |