C24H19N3O5S — CID 73148084
N-[2-(1,3-benzodioxol-5-yl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-carboxamide (PubChem CID 73148084) has the molecular formula C24H19N3O5S and a molecular weight of 461.50 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-carboxamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 73148084 |
| Molecular Formula | C24H19N3O5S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CCN2C(=O)c3cc(-c4ccc5c(c4)OCO5)ccc3NC(=O)C12)c1cccs1 |
| InChI | InChI=1S/C24H19N3O5S/c28-22(20-2-1-9-33-20)26-17-7-8-27-21(17)23(29)25-16-5-3-13(10-15(16)24(27)30)14-4-6-18-19(11-14)32-12-31-18/h1-6,9-11,17,21H,7-8,12H2,(H,25,29)(H,26,28) |
| InChIKey | BRPQTNWBBOEGOY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |