C17H14BrN3O3S — CID 11941858
N-[(6aS,7S)-2-bromo-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-carboxamide (PubChem CID 11941858) has the molecular formula C17H14BrN3O3S and a molecular weight of 420.29 g/mol. Its IUPAC name is N-[(6aS,7S)-2-bromo-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-carboxamide.
| Compound Name | N-[(6aS,7S)-2-bromo-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11941858 |
| Molecular Formula | C17H14BrN3O3S |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 418.99 |
| IUPAC Name | N-[(6aS,7S)-2-bromo-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@H]1CCN2C(=O)c3cc(Br)ccc3NC(=O)[C@H]12)c1cccs1 |
| InChI | InChI=1S/C17H14BrN3O3S/c18-9-3-4-11-10(8-9)17(24)21-6-5-12(14(21)16(23)19-11)20-15(22)13-2-1-7-25-13/h1-4,7-8,12,14H,5-6H2,(H,19,23)(H,20,22)/t12-,14-/m0/s1 |
| InChIKey | PWZKBMNTWGLLAX-JSGCOSHPSA-N |
| XLogP | 2.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |