C27H22FN3O4 — CID 163149003
N-[(6aS,7R)-2-[2-(4-hydroxyphenyl)ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]-3-fluorobenzamide (PubChem CID 163149003) has the molecular formula C27H22FN3O4 and a molecular weight of 471.49 g/mol. Its IUPAC name is N-[(6aS,7R)-2-[2-(4-hydroxyphenyl)ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]-3-fluorobenzamide.
| Compound Name | N-[(6aS,7R)-2-[2-(4-hydroxyphenyl)ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 163149003 |
| Molecular Formula | C27H22FN3O4 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-[(6aS,7R)-2-[2-(4-hydroxyphenyl)ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]-3-fluorobenzamide |
| SMILES | O=C(N[C@@H]1CCN2C(=O)c3cc(C=Cc4ccc(O)cc4)ccc3NC(=O)[C@H]12)c1cccc(F)c1 |
| InChI | InChI=1S/C27H22FN3O4/c28-19-3-1-2-18(15-19)25(33)30-23-12-13-31-24(23)26(34)29-22-11-8-17(14-21(22)27(31)35)5-4-16-6-9-20(32)10-7-16/h1-11,14-15,23-24,32H,12-13H2,(H,29,34)(H,30,33)/t23-,24+/m1/s1 |
| InChIKey | MQLNOLYNXYTZNA-RPWUZVMVSA-N |
| XLogP | 3.67 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|