C25H21N5O4 — CID 162807401
N-[(6aS,7S)-2-[2-(4-hydroxyphenyl)ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]pyrazine-2-carboxamide (PubChem CID 162807401) has the molecular formula C25H21N5O4 and a molecular weight of 455.47 g/mol. Its IUPAC name is N-[(6aS,7S)-2-[2-(4-hydroxyphenyl)ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(6aS,7S)-2-[2-(4-hydroxyphenyl)ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 162807401 |
| Molecular Formula | C25H21N5O4 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-[(6aS,7S)-2-[2-(4-hydroxyphenyl)ethenyl]-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]pyrazine-2-carboxamide |
| SMILES | O=C(N[C@H]1CCN2C(=O)c3cc(C=Cc4ccc(O)cc4)ccc3NC(=O)[C@H]12)c1cnccn1 |
| InChI | InChI=1S/C25H21N5O4/c31-17-6-3-15(4-7-17)1-2-16-5-8-19-18(13-16)25(34)30-12-9-20(22(30)24(33)28-19)29-23(32)21-14-26-10-11-27-21/h1-8,10-11,13-14,20,22,31H,9,12H2,(H,28,33)(H,29,32)/t20-,22-/m0/s1 |
| InChIKey | QECFIPDRAPUMFL-UNMCSNQZSA-N |
| XLogP | 2.32 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|