C19H19N5O3 — CID 162810844
N-[(3S,8S,8aS)-3-benzyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl]pyrazine-2-carboxamide (PubChem CID 162810844) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-[(3S,8S,8aS)-3-benzyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(3S,8S,8aS)-3-benzyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 162810844 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-[(3S,8S,8aS)-3-benzyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl]pyrazine-2-carboxamide |
| SMILES | O=C(N[C@H]1CCN2C(=O)[C@H](Cc3ccccc3)NC(=O)[C@H]12)c1cnccn1 |
| InChI | InChI=1S/C19H19N5O3/c25-17(15-11-20-7-8-21-15)22-13-6-9-24-16(13)18(26)23-14(19(24)27)10-12-4-2-1-3-5-12/h1-5,7-8,11,13-14,16H,6,9-10H2,(H,22,25)(H,23,26)/t13-,14-,16-/m0/s1 |
| InChIKey | VUNAKBJSNGWPML-DZKIICNBSA-N |
| XLogP | -0.08 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |