C17H22N4O5 — CID 163133591
3-[(3-benzyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl)amino]-N-hydroxy-3-oxopropan-1-amine oxide (PubChem CID 163133591) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is 3-[(3-benzyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl)amino]-N-hydroxy-3-oxopropan-1-amine oxide.
| Compound Name | 3-[(3-benzyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl)amino]-N-hydroxy-3-oxopropan-1-amine oxide |
|---|---|
| PubChem CID | 163133591 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-[(3-benzyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl)amino]-N-hydroxy-3-oxopropan-1-amine oxide |
| SMILES | O=C(CC[NH+]([O-])O)NC1CCN2C(=O)C(Cc3ccccc3)NC(=O)C12 |
| InChI | InChI=1S/C17H22N4O5/c22-14(7-9-21(25)26)18-12-6-8-20-15(12)16(23)19-13(17(20)24)10-11-4-2-1-3-5-11/h1-5,12-13,15,21,25H,6-10H2,(H,18,22)(H,19,23) |
| InChIKey | HBTAMWHFQJUWRR-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|