C28H41N5O6 — CID 59894799
6-[(3S,6R,9S,12R)-6-benzyl-3-(2-methylpropyl)-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]-N-hydroxyhexanamide (PubChem CID 59894799) has the molecular formula C28H41N5O6 and a molecular weight of 543.67 g/mol. Its IUPAC name is 6-[(3S,6R,9S,12R)-6-benzyl-3-(2-methylpropyl)-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]-N-hydroxyhexanamide.
| Compound Name | 6-[(3S,6R,9S,12R)-6-benzyl-3-(2-methylpropyl)-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 59894799 |
| Molecular Formula | C28H41N5O6 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | 6-[(3S,6R,9S,12R)-6-benzyl-3-(2-methylpropyl)-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]-N-hydroxyhexanamide |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CCCCCC(=O)NO)NC(=O)[C@H]2CCCN2C1=O |
| InChI | InChI=1S/C28H41N5O6/c1-18(2)16-22-28(38)33-15-9-13-23(33)27(37)29-20(12-7-4-8-14-24(34)32-39)25(35)30-21(26(36)31-22)17-19-10-5-3-6-11-19/h3,5-6,10-11,18,20-23,39H,4,7-9,12-17H2,1-2H3,(H,29,37)(H,30,35)(H,31,36)(H,32,34)/t20-,21+,22-,23+/m0/s1 |
| InChIKey | WPQXJKJFPMFGMJ-GSPCLOLRSA-N |
| XLogP | 1.19 |
| TPSA | 156.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|