C27H38N4O6 — CID 58726733
(6R,9S,12R)-3-benzyl-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 58726733) has the molecular formula C27H38N4O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is (6R,9S,12R)-3-benzyl-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (6R,9S,12R)-3-benzyl-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 58726733 |
| Molecular Formula | C27H38N4O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | (6R,9S,12R)-3-benzyl-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | C[C@@H](O)C(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCN2C(=O)C(Cc2ccccc2)NC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C27H38N4O6/c1-17-24(34)30-21(16-19-10-5-3-6-11-19)27(37)31-15-9-13-22(31)26(36)29-20(25(35)28-17)12-7-4-8-14-23(33)18(2)32/h3,5-6,10-11,17-18,20-22,32H,4,7-9,12-16H2,1-2H3,(H,28,35)(H,29,36)(H,30,34)/t17-,18-,20+,21?,22-/m1/s1 |
| InChIKey | FVUZPQAFALDGBR-MQBPYELZSA-N |
| XLogP | 0.61 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|