C43H56N4O6Si — CID 140508528
(6R,9S,12R)-3-benzyl-9-[(7S)-7-[tert-butyl(diphenyl)silyl]oxy-6-oxooctyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 140508528) has the molecular formula C43H56N4O6Si and a molecular weight of 753.03 g/mol. Its IUPAC name is (6R,9S,12R)-3-benzyl-9-[(7S)-7-[tert-butyl(diphenyl)silyl]oxy-6-oxooctyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (6R,9S,12R)-3-benzyl-9-[(7S)-7-[tert-butyl(diphenyl)silyl]oxy-6-oxooctyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 140508528 |
| Molecular Formula | C43H56N4O6Si |
| Molecular Weight | 753.03 g/mol |
| Exact Mass | 752.40 |
| IUPAC Name | (6R,9S,12R)-3-benzyl-9-[(7S)-7-[tert-butyl(diphenyl)silyl]oxy-6-oxooctyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCN2C(=O)C(Cc2ccccc2)NC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C43H56N4O6Si/c1-30-39(49)46-36(29-32-19-10-6-11-20-32)42(52)47-28-18-26-37(47)41(51)45-35(40(50)44-30)25-16-9-17-27-38(48)31(2)53-54(43(3,4)5,33-21-12-7-13-22-33)34-23-14-8-15-24-34/h6-8,10-15,19-24,30-31,35-37H,9,16-18,25-29H2,1-5H3,(H,44,50)(H,45,51)(H,46,49)/t30-,31+,35+,36?,37-/m1/s1 |
| InChIKey | CVGXUGVHNAQIMK-RTRCDOJKSA-N |
| XLogP | 4.19 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.03 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|