C39H56N4O6Si — CID 102296399
(3S,6S,9S,12R)-3,6-dibenzyl-9-[(7R)-7-[tert-butyl(dimethyl)silyl]oxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 102296399) has the molecular formula C39H56N4O6Si and a molecular weight of 704.99 g/mol. Its IUPAC name is (3S,6S,9S,12R)-3,6-dibenzyl-9-[(7R)-7-[tert-butyl(dimethyl)silyl]oxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R)-3,6-dibenzyl-9-[(7R)-7-[tert-butyl(dimethyl)silyl]oxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 102296399 |
| Molecular Formula | C39H56N4O6Si |
| Molecular Weight | 704.99 g/mol |
| Exact Mass | 704.40 |
| IUPAC Name | (3S,6S,9S,12R)-3,6-dibenzyl-9-[(7R)-7-[tert-butyl(dimethyl)silyl]oxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C39H56N4O6Si/c1-27(49-50(5,6)39(2,3)4)34(44)23-15-9-14-21-30-35(45)41-31(25-28-17-10-7-11-18-28)36(46)42-32(26-29-19-12-8-13-20-29)38(48)43-24-16-22-33(43)37(47)40-30/h7-8,10-13,17-20,27,30-33H,9,14-16,21-26H2,1-6H3,(H,40,47)(H,41,45)(H,42,46)/t27-,30+,31+,32+,33-/m1/s1 |
| InChIKey | AIPJRTWATJURMK-WOCWBZQBSA-N |
| XLogP | 4.86 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.99 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|