C31H46N4O6 — CID 98789154
(3S,6S,9S,12R)-6-benzyl-3-[(2S)-butan-2-yl]-9-[(7S)-7-hydroxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone (PubChem CID 98789154) has the molecular formula C31H46N4O6 and a molecular weight of 570.73 g/mol. Its IUPAC name is (3S,6S,9S,12R)-6-benzyl-3-[(2S)-butan-2-yl]-9-[(7S)-7-hydroxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R)-6-benzyl-3-[(2S)-butan-2-yl]-9-[(7S)-7-hydroxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 98789154 |
| Molecular Formula | C31H46N4O6 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | (3S,6S,9S,12R)-6-benzyl-3-[(2S)-butan-2-yl]-9-[(7S)-7-hydroxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CCCCCC(=O)[C@H](C)O)NC(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C31H46N4O6/c1-4-20(2)27-31(41)35-18-12-11-16-25(35)30(40)32-23(15-9-6-10-17-26(37)21(3)36)28(38)33-24(29(39)34-27)19-22-13-7-5-8-14-22/h5,7-8,13-14,20-21,23-25,27,36H,4,6,9-12,15-19H2,1-3H3,(H,32,40)(H,33,38)(H,34,39)/t20-,21-,23-,24-,25+,27-/m0/s1 |
| InChIKey | RWTAMSAIOGWNBT-LZRWNHGLSA-N |
| XLogP | 2.02 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|