C31H47N5O7 — CID 74992794
N-[5-[3-butan-2-yl-6-[(4-methoxyphenyl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]pentyl]-N-hydroxyacetamide (PubChem CID 74992794) has the molecular formula C31H47N5O7 and a molecular weight of 601.75 g/mol. Its IUPAC name is N-[5-[3-butan-2-yl-6-[(4-methoxyphenyl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]pentyl]-N-hydroxyacetamide.
| Compound Name | N-[5-[3-butan-2-yl-6-[(4-methoxyphenyl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]pentyl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 74992794 |
| Molecular Formula | C31H47N5O7 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | N-[5-[3-butan-2-yl-6-[(4-methoxyphenyl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]pentyl]-N-hydroxyacetamide |
| SMILES | CCC(C)C1NC(=O)C(Cc2ccc(OC)cc2)NC(=O)C(CCCCCN(O)C(C)=O)NC(=O)C2CCCCN2C1=O |
| InChI | InChI=1S/C31H47N5O7/c1-5-20(2)27-31(41)35-17-10-8-12-26(35)30(40)32-24(11-7-6-9-18-36(42)21(3)37)28(38)33-25(29(39)34-27)19-22-13-15-23(43-4)16-14-22/h13-16,20,24-27,42H,5-12,17-19H2,1-4H3,(H,32,40)(H,33,38)(H,34,39) |
| InChIKey | AWQWRNOUONAGSD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|