C33H47N5O6S — CID 101068917
S-[5-[(3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-6-[(1-methoxyindol-3-yl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]pentyl] ethanethioate (PubChem CID 101068917) has the molecular formula C33H47N5O6S and a molecular weight of 641.84 g/mol. Its IUPAC name is S-[5-[(3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-6-[(1-methoxyindol-3-yl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]pentyl] ethanethioate.
| Compound Name | S-[5-[(3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-6-[(1-methoxyindol-3-yl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]pentyl] ethanethioate |
|---|---|
| PubChem CID | 101068917 |
| Molecular Formula | C33H47N5O6S |
| Molecular Weight | 641.84 g/mol |
| Exact Mass | 641.32 |
| IUPAC Name | S-[5-[(3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-6-[(1-methoxyindol-3-yl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]pentyl] ethanethioate |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2cn(OC)c3ccccc23)NC(=O)[C@H](CCCCCSC(C)=O)NC(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C33H47N5O6S/c1-5-21(2)29-33(43)37-17-11-10-16-28(37)32(42)34-25(14-7-6-12-18-45-22(3)39)30(40)35-26(31(41)36-29)19-23-20-38(44-4)27-15-9-8-13-24(23)27/h8-9,13,15,20-21,25-26,28-29H,5-7,10-12,14,16-19H2,1-4H3,(H,34,42)(H,35,40)(H,36,41)/t21-,25-,26-,28+,29-/m0/s1 |
| InChIKey | OGMWXHMPOFCJCS-GTXHIHIZSA-N |
| XLogP | 2.98 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.84 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|