C35H45N5O6 — CID 91819781
(3S,6S,9S,12R)-3-benzyl-9-(6-hydroxyhexyl)-6-[(1-methoxyindol-3-yl)methyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone (PubChem CID 91819781) has the molecular formula C35H45N5O6 and a molecular weight of 631.77 g/mol. Its IUPAC name is (3S,6S,9S,12R)-3-benzyl-9-(6-hydroxyhexyl)-6-[(1-methoxyindol-3-yl)methyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R)-3-benzyl-9-(6-hydroxyhexyl)-6-[(1-methoxyindol-3-yl)methyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 91819781 |
| Molecular Formula | C35H45N5O6 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.34 |
| IUPAC Name | (3S,6S,9S,12R)-3-benzyl-9-(6-hydroxyhexyl)-6-[(1-methoxyindol-3-yl)methyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| SMILES | COn1cc(C[C@@H]2NC(=O)[C@H](CCCCCCO)NC(=O)[C@H]3CCCCN3C(=O)[C@H](Cc3ccccc3)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C35H45N5O6/c1-46-40-23-25(26-15-8-9-17-30(26)40)22-28-33(43)38-29(21-24-13-5-4-6-14-24)35(45)39-19-11-10-18-31(39)34(44)36-27(32(42)37-28)16-7-2-3-12-20-41/h4-6,8-9,13-15,17,23,27-29,31,41H,2-3,7,10-12,16,18-22H2,1H3,(H,36,44)(H,37,42)(H,38,43)/t27-,28-,29-,31+/m0/s1 |
| InChIKey | FCBWXCCQWZSOPS-MGUFQOSJSA-N |
| XLogP | 2.28 |
| TPSA | 142.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|