C30H41N5O6 — CID 101068980
4-[(3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-6-[(1-methoxyindol-3-yl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]butanal (PubChem CID 101068980) has the molecular formula C30H41N5O6 and a molecular weight of 567.69 g/mol. Its IUPAC name is 4-[(3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-6-[(1-methoxyindol-3-yl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]butanal.
| Compound Name | 4-[(3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-6-[(1-methoxyindol-3-yl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]butanal |
|---|---|
| PubChem CID | 101068980 |
| Molecular Formula | C30H41N5O6 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | 4-[(3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-6-[(1-methoxyindol-3-yl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]butanal |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2cn(OC)c3ccccc23)NC(=O)[C@H](CCCC=O)NC(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C30H41N5O6/c1-4-19(2)26-30(40)34-15-9-7-14-25(34)29(39)31-22(12-8-10-16-36)27(37)32-23(28(38)33-26)17-20-18-35(41-3)24-13-6-5-11-21(20)24/h5-6,11,13,16,18-19,22-23,25-26H,4,7-10,12,14-15,17H2,1-3H3,(H,31,39)(H,32,37)(H,33,38)/t19-,22-,23-,25+,26-/m0/s1 |
| InChIKey | UGONXUVLBREMHK-FKGHCGTHSA-N |
| XLogP | 1.51 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|