C32H46N4O6 — CID 157192230
(3S,6S,9R,12R)-3-butan-2-yl-9-(5-hydroxypentyl)-6-[(1-methoxyindol-3-yl)methyl]-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone (PubChem CID 157192230) has the molecular formula C32H46N4O6 and a molecular weight of 582.74 g/mol. Its IUPAC name is (3S,6S,9R,12R)-3-butan-2-yl-9-(5-hydroxypentyl)-6-[(1-methoxyindol-3-yl)methyl]-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9R,12R)-3-butan-2-yl-9-(5-hydroxypentyl)-6-[(1-methoxyindol-3-yl)methyl]-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 157192230 |
| Molecular Formula | C32H46N4O6 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.34 |
| IUPAC Name | (3S,6S,9R,12R)-3-butan-2-yl-9-(5-hydroxypentyl)-6-[(1-methoxyindol-3-yl)methyl]-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| SMILES | CCC(C)[C@@H]1NC(=O)[C@H](Cc2cn(OC)c3ccccc23)NC(=O)[C@H](CCCCCO)CC(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C32H46N4O6/c1-4-21(2)29-32(41)35-16-10-9-15-27(35)28(38)19-22(12-6-5-11-17-37)30(39)33-25(31(40)34-29)18-23-20-36(42-3)26-14-8-7-13-24(23)26/h7-8,13-14,20-22,25,27,29,37H,4-6,9-12,15-19H2,1-3H3,(H,33,39)(H,34,40)/t21?,22-,25+,27-,29+/m1/s1 |
| InChIKey | NHQDJZOWXKYSPW-DCKSLGKFSA-N |
| XLogP | 2.78 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|