C33H48N4O5S — CID 157257362
(3S,6S,9R,12R)-3-butan-2-yl-6-[(1-methoxyindol-3-yl)methyl]-9-(5-methylsulfanylpentyl)-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone (PubChem CID 157257362) has the molecular formula C33H48N4O5S and a molecular weight of 612.84 g/mol. Its IUPAC name is (3S,6S,9R,12R)-3-butan-2-yl-6-[(1-methoxyindol-3-yl)methyl]-9-(5-methylsulfanylpentyl)-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9R,12R)-3-butan-2-yl-6-[(1-methoxyindol-3-yl)methyl]-9-(5-methylsulfanylpentyl)-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 157257362 |
| Molecular Formula | C33H48N4O5S |
| Molecular Weight | 612.84 g/mol |
| Exact Mass | 612.33 |
| IUPAC Name | (3S,6S,9R,12R)-3-butan-2-yl-6-[(1-methoxyindol-3-yl)methyl]-9-(5-methylsulfanylpentyl)-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| SMILES | CCC(C)[C@@H]1NC(=O)[C@H](Cc2cn(OC)c3ccccc23)NC(=O)[C@H](CCCCCSC)CC(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C33H48N4O5S/c1-5-22(2)30-33(41)36-17-11-10-16-28(36)29(38)20-23(13-7-6-12-18-43-4)31(39)34-26(32(40)35-30)19-24-21-37(42-3)27-15-9-8-14-25(24)27/h8-9,14-15,21-23,26,28,30H,5-7,10-13,16-20H2,1-4H3,(H,34,39)(H,35,40)/t22?,23-,26+,28-,30+/m1/s1 |
| InChIKey | BKEUJBABFDCXLK-GFFWEZDXSA-N |
| XLogP | 4.15 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|