C34H49N5O4S2 — CID 102015419
(3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-9-[(1-methoxyindol-3-yl)methyl]-6-(6-oxooctyl)-5,8-bis(sulfanylidene)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,11-dione (PubChem CID 102015419) has the molecular formula C34H49N5O4S2 and a molecular weight of 655.93 g/mol. Its IUPAC name is (3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-9-[(1-methoxyindol-3-yl)methyl]-6-(6-oxooctyl)-5,8-bis(sulfanylidene)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,11-dione.
| Compound Name | (3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-9-[(1-methoxyindol-3-yl)methyl]-6-(6-oxooctyl)-5,8-bis(sulfanylidene)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,11-dione |
|---|---|
| PubChem CID | 102015419 |
| Molecular Formula | C34H49N5O4S2 |
| Molecular Weight | 655.93 g/mol |
| Exact Mass | 655.32 |
| IUPAC Name | (3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-9-[(1-methoxyindol-3-yl)methyl]-6-(6-oxooctyl)-5,8-bis(sulfanylidene)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,11-dione |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=S)[C@H](Cc2cn(OC)c3ccccc23)NC(=O)[C@H]2CCCCN2C(=O)[C@H]([C@@H](C)CC)NC1=S |
| InChI | InChI=1S/C34H49N5O4S2/c1-5-22(3)30-34(42)38-19-13-12-18-29(38)31(41)35-27(20-23-21-39(43-4)28-17-11-10-15-25(23)28)33(45)36-26(32(44)37-30)16-9-7-8-14-24(40)6-2/h10-11,15,17,21-22,26-27,29-30H,5-9,12-14,16,18-20H2,1-4H3,(H,35,41)(H,36,45)(H,37,44)/t22-,26-,27-,29+,30-/m0/s1 |
| InChIKey | YSRBKOYKYIMGIW-GMFLJSBRSA-N |
| XLogP | 4.67 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.93 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|