C33H47N5O6 — CID 70316422
(3S,6S,9S,12S)-9-butan-2-yl-6-[(1-hydroxyindol-3-yl)methyl]-3-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone (PubChem CID 70316422) has the molecular formula C33H47N5O6 and a molecular weight of 609.77 g/mol. Its IUPAC name is (3S,6S,9S,12S)-9-butan-2-yl-6-[(1-hydroxyindol-3-yl)methyl]-3-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12S)-9-butan-2-yl-6-[(1-hydroxyindol-3-yl)methyl]-3-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 70316422 |
| Molecular Formula | C33H47N5O6 |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.35 |
| IUPAC Name | (3S,6S,9S,12S)-9-butan-2-yl-6-[(1-hydroxyindol-3-yl)methyl]-3-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=O)[C@H](Cc2cn(O)c3ccccc23)NC(=O)[C@H](C(C)CC)NC(=O)[C@@H]2CCCCN2C1=O |
| InChI | InChI=1S/C33H47N5O6/c1-4-21(3)29-32(42)35-26(19-22-20-38(44)27-16-10-9-14-24(22)27)30(40)34-25(15-8-6-7-13-23(39)5-2)33(43)37-18-12-11-17-28(37)31(41)36-29/h9-10,14,16,20-21,25-26,28-29,44H,4-8,11-13,15,17-19H2,1-3H3,(H,34,40)(H,35,42)(H,36,41)/t21?,25-,26-,28-,29-/m0/s1 |
| InChIKey | UQMQHHCKFVCTTP-DDLPZQMXSA-N |
| XLogP | 3.25 |
| TPSA | 149.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|