C33H49N5O6 — CID 70273063
3-butan-2-yl-6-[(1-methoxyindol-3-yl)methyl]-9-(6-oxooctyl)-1-propyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone (PubChem CID 70273063) has the molecular formula C33H49N5O6 and a molecular weight of 611.78 g/mol. Its IUPAC name is 3-butan-2-yl-6-[(1-methoxyindol-3-yl)methyl]-9-(6-oxooctyl)-1-propyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone.
| Compound Name | 3-butan-2-yl-6-[(1-methoxyindol-3-yl)methyl]-9-(6-oxooctyl)-1-propyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 70273063 |
| Molecular Formula | C33H49N5O6 |
| Molecular Weight | 611.78 g/mol |
| Exact Mass | 611.37 |
| IUPAC Name | 3-butan-2-yl-6-[(1-methoxyindol-3-yl)methyl]-9-(6-oxooctyl)-1-propyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
| SMILES | CCCN1CC(=O)NC(CCCCCC(=O)CC)C(=O)NC(Cc2cn(OC)c3ccccc23)C(=O)NC(C(C)CC)C1=O |
| InChI | InChI=1S/C33H49N5O6/c1-6-18-37-21-29(40)34-26(16-11-9-10-14-24(39)8-3)31(41)35-27(32(42)36-30(33(37)43)22(4)7-2)19-23-20-38(44-5)28-17-13-12-15-25(23)28/h12-13,15,17,20,22,26-27,30H,6-11,14,16,18-19,21H2,1-5H3,(H,34,40)(H,35,41)(H,36,42) |
| InChIKey | JXIMTFISTBSLIQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.78 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|