C34H49N5O6 — CID 59061125
(3S,6S,9S,12R)-3-butan-2-yl-6-[[1-(hydroxymethyl)indol-3-yl]methyl]-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone (PubChem CID 59061125) has the molecular formula C34H49N5O6 and a molecular weight of 623.80 g/mol. Its IUPAC name is (3S,6S,9S,12R)-3-butan-2-yl-6-[[1-(hydroxymethyl)indol-3-yl]methyl]-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R)-3-butan-2-yl-6-[[1-(hydroxymethyl)indol-3-yl]methyl]-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 59061125 |
| Molecular Formula | C34H49N5O6 |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.37 |
| IUPAC Name | (3S,6S,9S,12R)-3-butan-2-yl-6-[[1-(hydroxymethyl)indol-3-yl]methyl]-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCCN2C(=O)[C@H](C(C)CC)NC(=O)[C@H](Cc2cn(CO)c3ccccc23)NC1=O |
| InChI | InChI=1S/C34H49N5O6/c1-4-22(3)30-34(45)39-18-12-11-17-29(39)33(44)35-26(15-8-6-7-13-24(41)5-2)31(42)36-27(32(43)37-30)19-23-20-38(21-40)28-16-10-9-14-25(23)28/h9-10,14,16,20,22,26-27,29-30,40H,4-8,11-13,15,17-19,21H2,1-3H3,(H,35,44)(H,36,42)(H,37,43)/t22?,26-,27-,29+,30-/m0/s1 |
| InChIKey | JVVZWHIMEHPIGM-LQJYRIKDSA-N |
| XLogP | 2.96 |
| TPSA | 149.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|