C28H37N5O6 — CID 59061067
2-[3-[[(3S,9S,12R)-3-butan-2-yl-9-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-6-yl]methyl]indol-1-yl]acetic acid (PubChem CID 59061067) has the molecular formula C28H37N5O6 and a molecular weight of 539.63 g/mol. Its IUPAC name is 2-[3-[[(3S,9S,12R)-3-butan-2-yl-9-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-6-yl]methyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[[(3S,9S,12R)-3-butan-2-yl-9-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-6-yl]methyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 59061067 |
| Molecular Formula | C28H37N5O6 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | 2-[3-[[(3S,9S,12R)-3-butan-2-yl-9-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-6-yl]methyl]indol-1-yl]acetic acid |
| SMILES | CCC(C)[C@@H]1NC(=O)C(Cc2cn(CC(=O)O)c3ccccc23)NC(=O)[C@H](C)NC(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C28H37N5O6/c1-4-16(2)24-28(39)33-12-8-7-11-22(33)27(38)29-17(3)25(36)30-20(26(37)31-24)13-18-14-32(15-23(34)35)21-10-6-5-9-19(18)21/h5-6,9-10,14,16-17,20,22,24H,4,7-8,11-13,15H2,1-3H3,(H,29,38)(H,30,36)(H,31,37)(H,34,35)/t16?,17-,20?,22+,24-/m0/s1 |
| InChIKey | RDCFLIWBSYPTPT-LJGFHRIZSA-N |
| XLogP | 1.18 |
| TPSA | 149.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |