C27H37N5O6S — CID 59061212
(3S,9S,12R)-3-butan-2-yl-9-methyl-6-[(1-methylsulfonylindol-3-yl)methyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone (PubChem CID 59061212) has the molecular formula C27H37N5O6S and a molecular weight of 559.69 g/mol. Its IUPAC name is (3S,9S,12R)-3-butan-2-yl-9-methyl-6-[(1-methylsulfonylindol-3-yl)methyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | (3S,9S,12R)-3-butan-2-yl-9-methyl-6-[(1-methylsulfonylindol-3-yl)methyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 59061212 |
| Molecular Formula | C27H37N5O6S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | (3S,9S,12R)-3-butan-2-yl-9-methyl-6-[(1-methylsulfonylindol-3-yl)methyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| SMILES | CCC(C)[C@@H]1NC(=O)C(Cc2cn(S(C)(=O)=O)c3ccccc23)NC(=O)[C@H](C)NC(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C27H37N5O6S/c1-5-16(2)23-27(36)31-13-9-8-12-22(31)26(35)28-17(3)24(33)29-20(25(34)30-23)14-18-15-32(39(4,37)38)21-11-7-6-10-19(18)21/h6-7,10-11,15-17,20,22-23H,5,8-9,12-14H2,1-4H3,(H,28,35)(H,29,33)(H,30,34)/t16?,17-,20?,22+,23-/m0/s1 |
| InChIKey | KHQAVKLDKUPJNK-ZKCOGJODSA-N |
| XLogP | 0.91 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |