C35H51N5O4S2 — CID 56668279
(4S,7S,10S,13R)-4-[(2S)-butan-2-yl]-7-[(1-methoxyindol-3-yl)methyl]-10-(6-oxooctyl)-6,9-bis(sulfanylidene)-1,5,8,11-tetrazabicyclo[11.4.0]heptadecane-3,12-dione (PubChem CID 56668279) has the molecular formula C35H51N5O4S2 and a molecular weight of 669.96 g/mol. Its IUPAC name is (4S,7S,10S,13R)-4-[(2S)-butan-2-yl]-7-[(1-methoxyindol-3-yl)methyl]-10-(6-oxooctyl)-6,9-bis(sulfanylidene)-1,5,8,11-tetrazabicyclo[11.4.0]heptadecane-3,12-dione.
| Compound Name | (4S,7S,10S,13R)-4-[(2S)-butan-2-yl]-7-[(1-methoxyindol-3-yl)methyl]-10-(6-oxooctyl)-6,9-bis(sulfanylidene)-1,5,8,11-tetrazabicyclo[11.4.0]heptadecane-3,12-dione |
|---|---|
| PubChem CID | 56668279 |
| Molecular Formula | C35H51N5O4S2 |
| Molecular Weight | 669.96 g/mol |
| Exact Mass | 669.34 |
| IUPAC Name | (4S,7S,10S,13R)-4-[(2S)-butan-2-yl]-7-[(1-methoxyindol-3-yl)methyl]-10-(6-oxooctyl)-6,9-bis(sulfanylidene)-1,5,8,11-tetrazabicyclo[11.4.0]heptadecane-3,12-dione |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCCN2CC(=O)[C@H]([C@@H](C)CC)NC(=S)[C@H](Cc2cn(OC)c3ccccc23)NC1=S |
| InChI | InChI=1S/C35H51N5O4S2/c1-5-23(3)32-31(42)22-39-19-13-12-18-30(39)33(43)36-27(16-9-7-8-14-25(41)6-2)34(45)37-28(35(46)38-32)20-24-21-40(44-4)29-17-11-10-15-26(24)29/h10-11,15,17,21,23,27-28,30,32H,5-9,12-14,16,18-20,22H2,1-4H3,(H,36,43)(H,37,45)(H,38,46)/t23-,27-,28-,30+,32-/m0/s1 |
| InChIKey | RTKPITSFVVVAGQ-YZQQIFRVSA-N |
| XLogP | 4.71 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.96 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|