C35H48N4O8 — CID 158046730
(3S,6S,9R,12R)-3-butan-2-yl-9-(7-hydroxy-6-oxooctyl)-6-(1-methoxyindole-3-carbonyl)-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone (PubChem CID 158046730) has the molecular formula C35H48N4O8 and a molecular weight of 652.79 g/mol. Its IUPAC name is (3S,6S,9R,12R)-3-butan-2-yl-9-(7-hydroxy-6-oxooctyl)-6-(1-methoxyindole-3-carbonyl)-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9R,12R)-3-butan-2-yl-9-(7-hydroxy-6-oxooctyl)-6-(1-methoxyindole-3-carbonyl)-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 158046730 |
| Molecular Formula | C35H48N4O8 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.35 |
| IUPAC Name | (3S,6S,9R,12R)-3-butan-2-yl-9-(7-hydroxy-6-oxooctyl)-6-(1-methoxyindole-3-carbonyl)-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| SMILES | CCC(C)[C@@H]1NC(=O)[C@H](C(=O)c2cn(OC)c3ccccc23)NC(=O)[C@H](CCCCCC(=O)C(C)O)CC(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C35H48N4O8/c1-5-21(2)30-35(46)38-18-12-11-16-27(38)29(42)19-23(13-7-6-8-17-28(41)22(3)40)33(44)37-31(34(45)36-30)32(43)25-20-39(47-4)26-15-10-9-14-24(25)26/h9-10,14-15,20-23,27,30-31,40H,5-8,11-13,16-19H2,1-4H3,(H,36,45)(H,37,44)/t21?,22?,23-,27-,30+,31+/m1/s1 |
| InChIKey | RXCXEZQBVGJVDR-UCZJPAPOSA-N |
| XLogP | 2.77 |
| TPSA | 164.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|