C30H45N5O7 — CID 56662147
N-[4-[(3S,6R,9S,12S)-3-[(2R)-butan-2-yl]-6-[(4-methoxyphenyl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]butyl]-N-hydroxyacetamide (PubChem CID 56662147) has the molecular formula C30H45N5O7 and a molecular weight of 587.72 g/mol. Its IUPAC name is N-[4-[(3S,6R,9S,12S)-3-[(2R)-butan-2-yl]-6-[(4-methoxyphenyl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]butyl]-N-hydroxyacetamide.
| Compound Name | N-[4-[(3S,6R,9S,12S)-3-[(2R)-butan-2-yl]-6-[(4-methoxyphenyl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]butyl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 56662147 |
| Molecular Formula | C30H45N5O7 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.33 |
| IUPAC Name | N-[4-[(3S,6R,9S,12S)-3-[(2R)-butan-2-yl]-6-[(4-methoxyphenyl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]butyl]-N-hydroxyacetamide |
| SMILES | CC[C@@H](C)[C@@H]1NC(=O)[C@@H](Cc2ccc(OC)cc2)NC(=O)[C@H](CCCCN(O)C(C)=O)NC(=O)[C@@H]2CCCCN2C1=O |
| InChI | InChI=1S/C30H45N5O7/c1-5-19(2)26-30(40)34-16-8-7-11-25(34)29(39)31-23(10-6-9-17-35(41)20(3)36)27(37)32-24(28(38)33-26)18-21-12-14-22(42-4)15-13-21/h12-15,19,23-26,41H,5-11,16-18H2,1-4H3,(H,31,39)(H,32,37)(H,33,38)/t19-,23+,24-,25+,26+/m1/s1 |
| InChIKey | VAPCKGJQNDLKMF-GGJIVPGBSA-N |
| XLogP | 1.54 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|