C27H39F3N6O6S — CID 59028842
(3R,6R,9S,12R)-3-butan-2-yl-2,5,8,11-tetraoxo-9-[4-(sulfamoylamino)butyl]-6-[[4-(trifluoromethyl)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane (PubChem CID 59028842) has the molecular formula C27H39F3N6O6S and a molecular weight of 632.71 g/mol. Its IUPAC name is (3R,6R,9S,12R)-3-butan-2-yl-2,5,8,11-tetraoxo-9-[4-(sulfamoylamino)butyl]-6-[[4-(trifluoromethyl)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane.
| Compound Name | (3R,6R,9S,12R)-3-butan-2-yl-2,5,8,11-tetraoxo-9-[4-(sulfamoylamino)butyl]-6-[[4-(trifluoromethyl)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane |
|---|---|
| PubChem CID | 59028842 |
| Molecular Formula | C27H39F3N6O6S |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | (3R,6R,9S,12R)-3-butan-2-yl-2,5,8,11-tetraoxo-9-[4-(sulfamoylamino)butyl]-6-[[4-(trifluoromethyl)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane |
| SMILES | CCC(C)[C@H]1NC(=O)[C@@H](Cc2ccc(C(F)(F)F)cc2)NC(=O)[C@H](CCCCNS(N)(=O)=O)NC(=O)[C@H]2CCCN2C1=O |
| InChI | InChI=1S/C27H39F3N6O6S/c1-3-16(2)22-26(40)36-14-6-8-21(36)25(39)33-19(7-4-5-13-32-43(31,41)42)23(37)34-20(24(38)35-22)15-17-9-11-18(12-10-17)27(28,29)30/h9-12,16,19-22,32H,3-8,13-15H2,1-2H3,(H,33,39)(H,34,37)(H,35,38)(H2,31,41,42)/t16?,19-,20+,21+,22+/m0/s1 |
| InChIKey | GUNBWBRRMYRAHW-NFHXIFCJSA-N |
| XLogP | 0.72 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|