C34H44N4O6 — CID 58726186
(3S,6R,9S,12R)-3-benzyl-6-ethyl-9-[(7R)-7-hydroxy-6-oxo-7-phenylheptyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 58726186) has the molecular formula C34H44N4O6 and a molecular weight of 604.75 g/mol. Its IUPAC name is (3S,6R,9S,12R)-3-benzyl-6-ethyl-9-[(7R)-7-hydroxy-6-oxo-7-phenylheptyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6R,9S,12R)-3-benzyl-6-ethyl-9-[(7R)-7-hydroxy-6-oxo-7-phenylheptyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 58726186 |
| Molecular Formula | C34H44N4O6 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | (3S,6R,9S,12R)-3-benzyl-6-ethyl-9-[(7R)-7-hydroxy-6-oxo-7-phenylheptyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC[C@@]1(C)NC(=O)[C@H](CCCCCC(=O)[C@H](O)c2ccccc2)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C34H44N4O6/c1-3-34(2)33(44)36-26(22-23-14-7-4-8-15-23)32(43)38-21-13-19-27(38)31(42)35-25(30(41)37-34)18-11-6-12-20-28(39)29(40)24-16-9-5-10-17-24/h4-5,7-10,14-17,25-27,29,40H,3,6,11-13,18-22H2,1-2H3,(H,35,42)(H,36,44)(H,37,41)/t25-,26-,27+,29+,34+/m0/s1 |
| InChIKey | UNKIZXDLIDWWIQ-VEWHCAEKSA-N |
| XLogP | 2.74 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|