C34H45N5O6 — CID 58726056
(3S,6S,9S,12R)-6-ethyl-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-3-[(4-pyridin-4-ylphenyl)methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 58726056) has the molecular formula C34H45N5O6 and a molecular weight of 619.76 g/mol. Its IUPAC name is (3S,6S,9S,12R)-6-ethyl-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-3-[(4-pyridin-4-ylphenyl)methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R)-6-ethyl-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-3-[(4-pyridin-4-ylphenyl)methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 58726056 |
| Molecular Formula | C34H45N5O6 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.34 |
| IUPAC Name | (3S,6S,9S,12R)-6-ethyl-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-3-[(4-pyridin-4-ylphenyl)methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCCCC(=O)[C@@H](C)O)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccc(-c3ccncc3)cc2)NC1=O |
| InChI | InChI=1S/C34H45N5O6/c1-4-34(3)33(45)37-27(21-23-12-14-24(15-13-23)25-16-18-35-19-17-25)32(44)39-20-8-10-28(39)31(43)36-26(30(42)38-34)9-6-5-7-11-29(41)22(2)40/h12-19,22,26-28,40H,4-11,20-21H2,1-3H3,(H,36,43)(H,37,45)(H,38,42)/t22-,26+,27+,28-,34+/m1/s1 |
| InChIKey | IGKLTPXGZSNLQZ-IQCCRWRYSA-N |
| XLogP | 2.45 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|