C29H43FN4O6 — CID 58726660
(3S,6S,9S,12R)-6-ethyl-9-(7-fluoro-6-hydroxyheptyl)-3-[(4-methoxyphenyl)methyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 58726660) has the molecular formula C29H43FN4O6 and a molecular weight of 562.68 g/mol. Its IUPAC name is (3S,6S,9S,12R)-6-ethyl-9-(7-fluoro-6-hydroxyheptyl)-3-[(4-methoxyphenyl)methyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R)-6-ethyl-9-(7-fluoro-6-hydroxyheptyl)-3-[(4-methoxyphenyl)methyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 58726660 |
| Molecular Formula | C29H43FN4O6 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | (3S,6S,9S,12R)-6-ethyl-9-(7-fluoro-6-hydroxyheptyl)-3-[(4-methoxyphenyl)methyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCCCC(O)CF)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccc(OC)cc2)NC1=O |
| InChI | InChI=1S/C29H43FN4O6/c1-4-29(2)28(39)32-23(17-19-12-14-21(40-3)15-13-19)27(38)34-16-8-11-24(34)26(37)31-22(25(36)33-29)10-7-5-6-9-20(35)18-30/h12-15,20,22-24,35H,4-11,16-18H2,1-3H3,(H,31,37)(H,32,39)(H,33,36)/t20?,22-,23-,24+,29-/m0/s1 |
| InChIKey | UUPYKUDFBLIWCE-NNSLPQKCSA-N |
| XLogP | 1.78 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|