C32H47N5O7 — CID 58726716
(3S,6S,9S,12R)-6-ethyl-9-(4-hydroxybutyl)-6-methyl-3-[[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 58726716) has the molecular formula C32H47N5O7 and a molecular weight of 613.76 g/mol. Its IUPAC name is (3S,6S,9S,12R)-6-ethyl-9-(4-hydroxybutyl)-6-methyl-3-[[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R)-6-ethyl-9-(4-hydroxybutyl)-6-methyl-3-[[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 58726716 |
| Molecular Formula | C32H47N5O7 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.35 |
| IUPAC Name | (3S,6S,9S,12R)-6-ethyl-9-(4-hydroxybutyl)-6-methyl-3-[[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCCO)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccc(OCC(=O)N3CCCCC3)cc2)NC1=O |
| InChI | InChI=1S/C32H47N5O7/c1-3-32(2)31(43)34-25(20-22-12-14-23(15-13-22)44-21-27(39)36-16-6-4-7-17-36)30(42)37-18-9-11-26(37)29(41)33-24(28(40)35-32)10-5-8-19-38/h12-15,24-26,38H,3-11,16-21H2,1-2H3,(H,33,41)(H,34,43)(H,35,40)/t24-,25-,26+,32-/m0/s1 |
| InChIKey | SOBBYGBHRABZSM-ZQIYOYMASA-N |
| XLogP | 1.04 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|