C25H35ClN4O5 — CID 58726188
(3S,6S,9S,12R)-3-[(4-chlorophenyl)methyl]-6-ethyl-9-(4-hydroxybutyl)-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 58726188) has the molecular formula C25H35ClN4O5 and a molecular weight of 507.03 g/mol. Its IUPAC name is (3S,6S,9S,12R)-3-[(4-chlorophenyl)methyl]-6-ethyl-9-(4-hydroxybutyl)-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R)-3-[(4-chlorophenyl)methyl]-6-ethyl-9-(4-hydroxybutyl)-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 58726188 |
| Molecular Formula | C25H35ClN4O5 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (3S,6S,9S,12R)-3-[(4-chlorophenyl)methyl]-6-ethyl-9-(4-hydroxybutyl)-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCCO)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccc(Cl)cc2)NC1=O |
| InChI | InChI=1S/C25H35ClN4O5/c1-3-25(2)24(35)28-19(15-16-9-11-17(26)12-10-16)23(34)30-13-6-8-20(30)22(33)27-18(21(32)29-25)7-4-5-14-31/h9-12,18-20,31H,3-8,13-15H2,1-2H3,(H,27,33)(H,28,35)(H,29,32)/t18-,19-,20+,25-/m0/s1 |
| InChIKey | ZTVBWDLIJLBUQD-KSYXXAMZSA-N |
| XLogP | 1.30 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|