C30H44N4O7 — CID 22726555
(3S,6S,9S)-6-ethyl-9-[(7R)-7-hydroxy-6-oxooctyl]-3-[(4-methoxyphenyl)methyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 22726555) has the molecular formula C30H44N4O7 and a molecular weight of 572.70 g/mol. Its IUPAC name is (3S,6S,9S)-6-ethyl-9-[(7R)-7-hydroxy-6-oxooctyl]-3-[(4-methoxyphenyl)methyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S)-6-ethyl-9-[(7R)-7-hydroxy-6-oxooctyl]-3-[(4-methoxyphenyl)methyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 22726555 |
| Molecular Formula | C30H44N4O7 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | (3S,6S,9S)-6-ethyl-9-[(7R)-7-hydroxy-6-oxooctyl]-3-[(4-methoxyphenyl)methyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCCCC(=O)[C@@H](C)O)NC(=O)C2CCCN2C(=O)[C@H](Cc2ccc(OC)cc2)NC1=O |
| InChI | InChI=1S/C30H44N4O7/c1-5-30(3)29(40)32-23(18-20-13-15-21(41-4)16-14-20)28(39)34-17-9-11-24(34)27(38)31-22(26(37)33-30)10-7-6-8-12-25(36)19(2)35/h13-16,19,22-24,35H,5-12,17-18H2,1-4H3,(H,31,38)(H,32,40)(H,33,37)/t19-,22+,23+,24?,30+/m1/s1 |
| InChIKey | OSKMWEWFCQXHKV-IUDPUGKESA-N |
| XLogP | 1.40 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|