C29H41FN4O6 — CID 10128926
(3R,6S,9S)-6-ethyl-3-[(2-fluorophenyl)methyl]-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 10128926) has the molecular formula C29H41FN4O6 and a molecular weight of 560.67 g/mol. Its IUPAC name is (3R,6S,9S)-6-ethyl-3-[(2-fluorophenyl)methyl]-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9S)-6-ethyl-3-[(2-fluorophenyl)methyl]-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 10128926 |
| Molecular Formula | C29H41FN4O6 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | (3R,6S,9S)-6-ethyl-3-[(2-fluorophenyl)methyl]-9-[(7R)-7-hydroxy-6-oxooctyl]-6-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCCCC(=O)[C@@H](C)O)NC(=O)C2CCCN2C(=O)[C@@H](Cc2ccccc2F)NC1=O |
| InChI | InChI=1S/C29H41FN4O6/c1-4-29(3)28(40)32-22(17-19-11-8-9-12-20(19)30)27(39)34-16-10-14-23(34)26(38)31-21(25(37)33-29)13-6-5-7-15-24(36)18(2)35/h8-9,11-12,18,21-23,35H,4-7,10,13-17H2,1-3H3,(H,31,38)(H,32,40)(H,33,37)/t18-,21+,22-,23?,29+/m1/s1 |
| InChIKey | MKESNCRQEHKYPS-HOHLYJJJSA-N |
| XLogP | 1.53 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|