C26H35ClN4O6 — CID 58726333
4-[(3S,6S,9S,12R)-3-[(4-chloro-3-methoxyphenyl)methyl]-6-ethyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal (PubChem CID 58726333) has the molecular formula C26H35ClN4O6 and a molecular weight of 535.04 g/mol. Its IUPAC name is 4-[(3S,6S,9S,12R)-3-[(4-chloro-3-methoxyphenyl)methyl]-6-ethyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal.
| Compound Name | 4-[(3S,6S,9S,12R)-3-[(4-chloro-3-methoxyphenyl)methyl]-6-ethyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal |
|---|---|
| PubChem CID | 58726333 |
| Molecular Formula | C26H35ClN4O6 |
| Molecular Weight | 535.04 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 4-[(3S,6S,9S,12R)-3-[(4-chloro-3-methoxyphenyl)methyl]-6-ethyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCC=O)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccc(Cl)c(OC)c2)NC1=O |
| InChI | InChI=1S/C26H35ClN4O6/c1-4-26(2)25(36)29-19(14-16-10-11-17(27)21(15-16)37-3)24(35)31-12-7-9-20(31)23(34)28-18(22(33)30-26)8-5-6-13-32/h10-11,13,15,18-20H,4-9,12,14H2,1-3H3,(H,28,34)(H,29,36)(H,30,33)/t18-,19-,20+,26-/m0/s1 |
| InChIKey | NJIRHYVZBHDJKA-FDTRYVBHSA-N |
| XLogP | 1.52 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.04 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|