C26H35N5O6 — CID 58726744
2-[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-9-(4-oxobutyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-3-yl]-N-phenylacetamide (PubChem CID 58726744) has the molecular formula C26H35N5O6 and a molecular weight of 513.60 g/mol. Its IUPAC name is 2-[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-9-(4-oxobutyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-3-yl]-N-phenylacetamide.
| Compound Name | 2-[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-9-(4-oxobutyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 58726744 |
| Molecular Formula | C26H35N5O6 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 2-[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-9-(4-oxobutyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-3-yl]-N-phenylacetamide |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCC=O)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)Nc2ccccc2)NC1=O |
| InChI | InChI=1S/C26H35N5O6/c1-3-26(2)25(37)29-19(16-21(33)27-17-10-5-4-6-11-17)24(36)31-14-9-13-20(31)23(35)28-18(22(34)30-26)12-7-8-15-32/h4-6,10-11,15,18-20H,3,7-9,12-14,16H2,1-2H3,(H,27,33)(H,28,35)(H,29,37)(H,30,34)/t18-,19-,20+,26-/m0/s1 |
| InChIKey | NQVUNGJBZMECCR-FDTRYVBHSA-N |
| XLogP | 0.64 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|