C33H41N5O7 — CID 58726071
4-[(3S,6S,9S,12R)-3-(2-anilino-2-oxoethyl)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl benzoate (PubChem CID 58726071) has the molecular formula C33H41N5O7 and a molecular weight of 619.72 g/mol. Its IUPAC name is 4-[(3S,6S,9S,12R)-3-(2-anilino-2-oxoethyl)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl benzoate.
| Compound Name | 4-[(3S,6S,9S,12R)-3-(2-anilino-2-oxoethyl)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl benzoate |
|---|---|
| PubChem CID | 58726071 |
| Molecular Formula | C33H41N5O7 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | 4-[(3S,6S,9S,12R)-3-(2-anilino-2-oxoethyl)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl benzoate |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCCOC(=O)c2ccccc2)NC(=O)[C@H]2CCCN2C(=O)[C@H](CC(=O)Nc2ccccc2)NC1=O |
| InChI | InChI=1S/C33H41N5O7/c1-3-33(2)32(44)36-25(21-27(39)34-23-15-8-5-9-16-23)30(42)38-19-12-18-26(38)29(41)35-24(28(40)37-33)17-10-11-20-45-31(43)22-13-6-4-7-14-22/h4-9,13-16,24-26H,3,10-12,17-21H2,1-2H3,(H,34,39)(H,35,41)(H,36,44)(H,37,40)/t24-,25-,26+,33-/m0/s1 |
| InChIKey | DHSMCGDHRVSJFD-UWWLJTJFSA-N |
| XLogP | 2.30 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|