C33H42N4O6 — CID 58726049
4-[(6S,9S,12R)-3-benzyl-6-methyl-2,5,8,11-tetraoxo-6-propan-2-yl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl benzoate (PubChem CID 58726049) has the molecular formula C33H42N4O6 and a molecular weight of 590.72 g/mol. Its IUPAC name is 4-[(6S,9S,12R)-3-benzyl-6-methyl-2,5,8,11-tetraoxo-6-propan-2-yl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl benzoate.
| Compound Name | 4-[(6S,9S,12R)-3-benzyl-6-methyl-2,5,8,11-tetraoxo-6-propan-2-yl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl benzoate |
|---|---|
| PubChem CID | 58726049 |
| Molecular Formula | C33H42N4O6 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | 4-[(6S,9S,12R)-3-benzyl-6-methyl-2,5,8,11-tetraoxo-6-propan-2-yl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl benzoate |
| SMILES | CC(C)[C@]1(C)NC(=O)[C@H](CCCCOC(=O)c2ccccc2)NC(=O)[C@H]2CCCN2C(=O)C(Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C33H42N4O6/c1-22(2)33(3)32(42)35-26(21-23-13-6-4-7-14-23)30(40)37-19-12-18-27(37)29(39)34-25(28(38)36-33)17-10-11-20-43-31(41)24-15-8-5-9-16-24/h4-9,13-16,22,25-27H,10-12,17-21H2,1-3H3,(H,34,39)(H,35,42)(H,36,38)/t25-,26?,27+,33-/m0/s1 |
| InChIKey | KUNQPAGRGHSPDE-FXAARSPNSA-N |
| XLogP | 2.76 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|