C27H38ClN5O6 — CID 10257314
N-[4-[(3S,9S,12R)-3-benzyl-6,6-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl]-3-chloro-2-hydroxypropanamide (PubChem CID 10257314) has the molecular formula C27H38ClN5O6 and a molecular weight of 564.08 g/mol. Its IUPAC name is N-[4-[(3S,9S,12R)-3-benzyl-6,6-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl]-3-chloro-2-hydroxypropanamide.
| Compound Name | N-[4-[(3S,9S,12R)-3-benzyl-6,6-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl]-3-chloro-2-hydroxypropanamide |
|---|---|
| PubChem CID | 10257314 |
| Molecular Formula | C27H38ClN5O6 |
| Molecular Weight | 564.08 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | N-[4-[(3S,9S,12R)-3-benzyl-6,6-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl]-3-chloro-2-hydroxypropanamide |
| SMILES | CC1(C)NC(=O)[C@H](CCCCNC(=O)C(O)CCl)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C27H38ClN5O6/c1-27(2)26(39)31-19(15-17-9-4-3-5-10-17)25(38)33-14-8-12-20(33)23(36)30-18(22(35)32-27)11-6-7-13-29-24(37)21(34)16-28/h3-5,9-10,18-21,34H,6-8,11-16H2,1-2H3,(H,29,37)(H,30,36)(H,31,39)(H,32,35)/t18-,19-,20+,21?/m0/s1 |
| InChIKey | OSQLHZLMAAKPMU-CBQMWWCCSA-N |
| XLogP | -0.02 |
| TPSA | 156.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.08 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|