C37H42N4O6 — CID 58726080
4-[(6R,9S,12R)-3,6-dibenzyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl benzoate (PubChem CID 58726080) has the molecular formula C37H42N4O6 and a molecular weight of 638.77 g/mol. Its IUPAC name is 4-[(6R,9S,12R)-3,6-dibenzyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl benzoate.
| Compound Name | 4-[(6R,9S,12R)-3,6-dibenzyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl benzoate |
|---|---|
| PubChem CID | 58726080 |
| Molecular Formula | C37H42N4O6 |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | 4-[(6R,9S,12R)-3,6-dibenzyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butyl benzoate |
| SMILES | C[C@]1(Cc2ccccc2)NC(=O)[C@H](CCCCOC(=O)c2ccccc2)NC(=O)[C@H]2CCCN2C(=O)C(Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C37H42N4O6/c1-37(25-27-16-7-3-8-17-27)36(46)39-30(24-26-14-5-2-6-15-26)34(44)41-22-13-21-31(41)33(43)38-29(32(42)40-37)20-11-12-23-47-35(45)28-18-9-4-10-19-28/h2-10,14-19,29-31H,11-13,20-25H2,1H3,(H,38,43)(H,39,46)(H,40,42)/t29-,30?,31+,37+/m0/s1 |
| InChIKey | OPVSZAFMFKPOHF-JHOFXJAWSA-N |
| XLogP | 3.35 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|