C25H34N4O5 — CID 58726465
4-[(3S,6R,9S,12R)-3-benzyl-6-ethyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal (PubChem CID 58726465) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is 4-[(3S,6R,9S,12R)-3-benzyl-6-ethyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal.
| Compound Name | 4-[(3S,6R,9S,12R)-3-benzyl-6-ethyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal |
|---|---|
| PubChem CID | 58726465 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 4-[(3S,6R,9S,12R)-3-benzyl-6-ethyl-6-methyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal |
| SMILES | CC[C@@]1(C)NC(=O)[C@H](CCCC=O)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C25H34N4O5/c1-3-25(2)24(34)27-19(16-17-10-5-4-6-11-17)23(33)29-14-9-13-20(29)22(32)26-18(21(31)28-25)12-7-8-15-30/h4-6,10-11,15,18-20H,3,7-9,12-14,16H2,1-2H3,(H,26,32)(H,27,34)(H,28,31)/t18-,19-,20+,25+/m0/s1 |
| InChIKey | ONWLVERPWMJHSU-UVPKRVSESA-N |
| XLogP | 0.86 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|