C28H38N4O5 — CID 58726471
4-[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-3-[(4-prop-1-en-2-ylphenyl)methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal (PubChem CID 58726471) has the molecular formula C28H38N4O5 and a molecular weight of 510.64 g/mol. Its IUPAC name is 4-[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-3-[(4-prop-1-en-2-ylphenyl)methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal.
| Compound Name | 4-[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-3-[(4-prop-1-en-2-ylphenyl)methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal |
|---|---|
| PubChem CID | 58726471 |
| Molecular Formula | C28H38N4O5 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | 4-[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-3-[(4-prop-1-en-2-ylphenyl)methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal |
| SMILES | C=C(C)c1ccc(C[C@@H]2NC(=O)[C@](C)(CC)NC(=O)[C@H](CCCC=O)NC(=O)[C@H]3CCCN3C2=O)cc1 |
| InChI | InChI=1S/C28H38N4O5/c1-5-28(4)27(37)30-22(17-19-11-13-20(14-12-19)18(2)3)26(36)32-15-8-10-23(32)25(35)29-21(24(34)31-28)9-6-7-16-33/h11-14,16,21-23H,2,5-10,15,17H2,1,3-4H3,(H,29,35)(H,30,37)(H,31,34)/t21-,22-,23+,28-/m0/s1 |
| InChIKey | DDVFGBVARXMFAH-QKFCCHLXSA-N |
| XLogP | 1.89 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|