C24H33N5O5 — CID 58726355
4-[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-3-(pyridin-4-ylmethyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal (PubChem CID 58726355) has the molecular formula C24H33N5O5 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-3-(pyridin-4-ylmethyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal.
| Compound Name | 4-[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-3-(pyridin-4-ylmethyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal |
|---|---|
| PubChem CID | 58726355 |
| Molecular Formula | C24H33N5O5 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 4-[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-3-(pyridin-4-ylmethyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]butanal |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCC=O)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccncc2)NC1=O |
| InChI | InChI=1S/C24H33N5O5/c1-3-24(2)23(34)27-18(15-16-9-11-25-12-10-16)22(33)29-13-6-8-19(29)21(32)26-17(20(31)28-24)7-4-5-14-30/h9-12,14,17-19H,3-8,13,15H2,1-2H3,(H,26,32)(H,27,34)(H,28,31)/t17-,18-,19+,24-/m0/s1 |
| InChIKey | CVOYBYYZRSVEDF-RGKFVRLKSA-N |
| XLogP | 0.25 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|