C32H39N5O6 — CID 58726076
4-[[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-9-(4-oxobutyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-3-yl]methyl]-N-phenylbenzamide (PubChem CID 58726076) has the molecular formula C32H39N5O6 and a molecular weight of 589.69 g/mol. Its IUPAC name is 4-[[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-9-(4-oxobutyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-3-yl]methyl]-N-phenylbenzamide.
| Compound Name | 4-[[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-9-(4-oxobutyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-3-yl]methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 58726076 |
| Molecular Formula | C32H39N5O6 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | 4-[[(3S,6S,9S,12R)-6-ethyl-6-methyl-2,5,8,11-tetraoxo-9-(4-oxobutyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-3-yl]methyl]-N-phenylbenzamide |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCC=O)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccc(C(=O)Nc3ccccc3)cc2)NC1=O |
| InChI | InChI=1S/C32H39N5O6/c1-3-32(2)31(43)35-25(20-21-14-16-22(17-15-21)27(39)33-23-10-5-4-6-11-23)30(42)37-18-9-13-26(37)29(41)34-24(28(40)36-32)12-7-8-19-38/h4-6,10-11,14-17,19,24-26H,3,7-9,12-13,18,20H2,1-2H3,(H,33,39)(H,34,41)(H,35,43)(H,36,40)/t24-,25-,26+,32-/m0/s1 |
| InChIKey | STWQMFVZRDWEDS-ZQIYOYMASA-N |
| XLogP | 2.11 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|