C21H23N4O4+ — CID 11884293
[2-[(4aS)-9-(4-methoxyphenyl)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]azanium (PubChem CID 11884293) has the molecular formula C21H23N4O4+ and a molecular weight of 395.44 g/mol. Its IUPAC name is [2-[(4aS)-9-(4-methoxyphenyl)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]azanium.
| Compound Name | [2-[(4aS)-9-(4-methoxyphenyl)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 11884293 |
| Molecular Formula | C21H23N4O4+ |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [2-[(4aS)-9-(4-methoxyphenyl)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-2-oxoethyl]azanium |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)N2CCN(C(=O)C[NH3+])C[C@H]2C(=O)N3)cc1 |
| InChI | InChI=1S/C21H22N4O4/c1-29-15-5-2-13(3-6-15)14-4-7-17-16(10-14)21(28)25-9-8-24(19(26)11-22)12-18(25)20(27)23-17/h2-7,10,18H,8-9,11-12,22H2,1H3,(H,23,27)/p+1/t18-/m0/s1 |
| InChIKey | XXQUAQGRSSOAKV-SFHVURJKSA-O |
| XLogP | 0.21 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |