C20H17N3O5S2 — CID 3871501
N-[2-(furan-2-yl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]thiophene-2-sulfonamide (PubChem CID 3871501) has the molecular formula C20H17N3O5S2 and a molecular weight of 443.51 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(furan-2-yl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3871501 |
| Molecular Formula | C20H17N3O5S2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | N-[2-(furan-2-yl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]thiophene-2-sulfonamide |
| SMILES | O=C1Nc2ccc(-c3ccco3)cc2C(=O)N2CC(NS(=O)(=O)c3cccs3)CC12 |
| InChI | InChI=1S/C20H17N3O5S2/c24-19-16-10-13(22-30(26,27)18-4-2-8-29-18)11-23(16)20(25)14-9-12(5-6-15(14)21-19)17-3-1-7-28-17/h1-9,13,16,22H,10-11H2,(H,21,24) |
| InChIKey | IVXUYWVZNQPIKF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |