C21H19N7O4S — CID 4988066
1-(6,12-dioxo-2-thiophen-2-yl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)triazole-4,5-dicarboxamide (PubChem CID 4988066) has the molecular formula C21H19N7O4S and a molecular weight of 465.50 g/mol. Its IUPAC name is 1-(6,12-dioxo-2-thiophen-2-yl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)triazole-4,5-dicarboxamide.
| Compound Name | 1-(6,12-dioxo-2-thiophen-2-yl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)triazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 4988066 |
| Molecular Formula | C21H19N7O4S |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 1-(6,12-dioxo-2-thiophen-2-yl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl)triazole-4,5-dicarboxamide |
| SMILES | NC(=O)c1nnn(C2CCN3C(=O)c4cc(-c5cccs5)ccc4NC(=O)C3C2)c1C(N)=O |
| InChI | InChI=1S/C21H19N7O4S/c22-18(29)16-17(19(23)30)28(26-25-16)11-5-6-27-14(9-11)20(31)24-13-4-3-10(8-12(13)21(27)32)15-2-1-7-33-15/h1-4,7-8,11,14H,5-6,9H2,(H2,22,29)(H2,23,30)(H,24,31) |
| InChIKey | LWSYRLZBHAEHEH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 166.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |