C16H23N7O4 — CID 3703996
1-[3-(2-methylpropyl)-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]triazole-4,5-dicarboxamide (PubChem CID 3703996) has the molecular formula C16H23N7O4 and a molecular weight of 377.41 g/mol. Its IUPAC name is 1-[3-(2-methylpropyl)-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]triazole-4,5-dicarboxamide.
| Compound Name | 1-[3-(2-methylpropyl)-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]triazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 3703996 |
| Molecular Formula | C16H23N7O4 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 1-[3-(2-methylpropyl)-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]triazole-4,5-dicarboxamide |
| SMILES | CC(C)CC1NC(=O)C2CC(n3nnc(C(N)=O)c3C(N)=O)CCN2C1=O |
| InChI | InChI=1S/C16H23N7O4/c1-7(2)5-9-16(27)22-4-3-8(6-10(22)15(26)19-9)23-12(14(18)25)11(13(17)24)20-21-23/h7-10H,3-6H2,1-2H3,(H2,17,24)(H2,18,25)(H,19,26) |
| InChIKey | VBSRNLHDKLRWAG-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 166.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |